CAS 2802455-63-4 is the registry number for Ethyl 3-methyl-5-nitro-6-oxo-1,6-dihydropyridine-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 3-methyl-5-nitro-6-oxo-1H-pyridine-2-carboxylate (CAS 2802455-63-4) is a chemical compound with the molecular formula C9H10N2O5 and a molecular weight of 226.19 g/mol. IUPAC name: ethyl 3-methyl-5-nitro-6-oxo-1H-pyridine-2-carboxylate. InChIKey: DXXSWAIBNWPSRO-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O5 |
|---|---|
| Molecular weight | 226.19 g/mol |
| IUPAC name | ethyl 3-methyl-5-nitro-6-oxo-1H-pyridine-2-carboxylate |
| InChIKey | DXXSWAIBNWPSRO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(C(=O)N1)[N+](=O)[O-])C |
Computed by PubChem (NCBI)