Products 2803419-94-3

CAS 2803419-94-3 is the registry number for (R)-2-Amino-2-methylpent-4-ynoic acid hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

(2R)-2-amino-2-methylpent-4-ynoic acid;hydrochloride (CAS 2803419-94-3) is a chemical compound with the molecular formula C6H10ClNO2 and a molecular weight of 163.60 g/mol. IUPAC name: (2R)-2-amino-2-methylpent-4-ynoic acid;hydrochloride. InChIKey: CKYARWJSMYTCAT-FYZOBXCZSA-N.

Identity
Molecular formulaC6H10ClNO2
Molecular weight163.60 g/mol
IUPAC name(2R)-2-amino-2-methylpent-4-ynoic acid;hydrochloride
InChIKeyCKYARWJSMYTCAT-FYZOBXCZSA-N
SMILESC[C@@](CC#C)(C(=O)O)N.Cl

Computed by PubChem (NCBI)