Products 2803420-25-7
CAS 2803420-25-7 is the registry number for 3-(2-Chlorophenyl)butanoic acid, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(2R)-1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylic acid (CAS 2803420-25-7) is a chemical compound with the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. IUPAC name: (2R)-1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylic acid. InChIKey: GWXADOKFGBKLOD-SECBINFHSA-N.
| Molecular formula | C13H21NO4 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | (2R)-1-(3,3-dimethyl-2-oxopentanoyl)piperidine-2-carboxylic acid |
| InChIKey | GWXADOKFGBKLOD-SECBINFHSA-N |
| SMILES | CCC(C)(C)C(=O)C(=O)N1CCCC[C@@H]1C(=O)O |
Computed by PubChem (NCBI)