Products 2803476-80-2
CAS 2803476-80-2 appears in our catalog under these names: (3S,4R)-3-fluoropiperidine-4-carboxylic acid hydrochloride, 97%, 97%, Edoxaban impurity 59, 97.0%. Offered by: Chemat, MedChemExpress. Available pack sizes: 50mg, 25 mg, 50 mg, 5 mg, 10 mg.
Ethyl 2-[(6-chloro-2-pyridinyl)amino]-2-oxoacetate (CAS 2803476-80-2) is a chemical compound with the molecular formula C9H9ClN2O3 and a molecular weight of 228.63 g/mol. IUPAC name: ethyl 2-[(6-chloro-2-pyridinyl)amino]-2-oxoacetate. InChIKey: XYRYQLIAKFMJKC-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2O3 |
|---|---|
| Molecular weight | 228.63 g/mol |
| IUPAC name | ethyl 2-[(6-chloro-2-pyridinyl)amino]-2-oxoacetate |
| InChIKey | XYRYQLIAKFMJKC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)NC1=NC(=CC=C1)Cl |
Computed by PubChem (NCBI)