Products 2805194-64-1
CAS 2805194-64-1 is the registry number for 5,5'-(Phenazine-5,10-diyl)diisophthalaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[10-(3,5-diformylphenyl)phenazin-5-yl]benzene-1,3-dicarbaldehyde (CAS 2805194-64-1) is a chemical compound with the molecular formula C28H18N2O4 and a molecular weight of 446.5 g/mol. IUPAC name: 5-[10-(3,5-diformylphenyl)phenazin-5-yl]benzene-1,3-dicarbaldehyde. InChIKey: DMUKPKYOMYNMIU-UHFFFAOYSA-N.
| Molecular formula | C28H18N2O4 |
|---|---|
| Molecular weight | 446.5 g/mol |
| IUPAC name | 5-[10-(3,5-diformylphenyl)phenazin-5-yl]benzene-1,3-dicarbaldehyde |
| InChIKey | DMUKPKYOMYNMIU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N(C3=CC=CC=C3N2C4=CC(=CC(=C4)C=O)C=O)C5=CC(=CC(=C5)C=O)C=O |
Computed by PubChem (NCBI)