CAS 82-18-8 appears in our catalog under these names: N,N'-(9,10-Dioxo-9,10-dihydroanthracene-1,5-diyl)dibenzamide, 97%, 97%, N,N'-(9,10-Dioxo-9,10-dihydroanthracene-1,5-diyl)dibenzamide, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
N-(5-benzamido-9,10-dioxoanthracen-1-yl)benzamide (CAS 82-18-8) is a chemical compound with the molecular formula C28H18N2O4 and a molecular weight of 446.5 g/mol. IUPAC name: N-(5-benzamido-9,10-dioxoanthracen-1-yl)benzamide. InChIKey: PZNXLZZWWBSQQK-UHFFFAOYSA-N.
| Molecular formula | C28H18N2O4 |
|---|---|
| Molecular weight | 446.5 g/mol |
| IUPAC name | N-(5-benzamido-9,10-dioxoanthracen-1-yl)benzamide |
| InChIKey | PZNXLZZWWBSQQK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=CC=CC3=C2C(=O)C4=C(C3=O)C(=CC=C4)NC(=O)C5=CC=CC=C5 |
Computed by PubChem (NCBI)