CAS 2987-68-0 is the registry number for N,N'-(9,10-Dioxo-9,10-dihydroanthracene-1,4-diyl)dibenzamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(4-benzamido-9,10-dioxoanthracen-1-yl)benzamide (CAS 2987-68-0) is a chemical compound with the molecular formula C28H18N2O4 and a molecular weight of 446.5 g/mol. IUPAC name: N-(4-benzamido-9,10-dioxoanthracen-1-yl)benzamide. InChIKey: SMYVNUCSIRQQNT-UHFFFAOYSA-N.
| Molecular formula | C28H18N2O4 |
|---|---|
| Molecular weight | 446.5 g/mol |
| IUPAC name | N-(4-benzamido-9,10-dioxoanthracen-1-yl)benzamide |
| InChIKey | SMYVNUCSIRQQNT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=C3C(=C(C=C2)NC(=O)C4=CC=CC=C4)C(=O)C5=CC=CC=C5C3=O |
Computed by PubChem (NCBI)