CAS 2806023-03-8 is the registry number for (S)-4-Chloro-8-methoxy-2,6,8-trimethyl-6,8-dihydro-7H-pyrrolo[2,3-g]quinazolin-7-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(8S)-4-chloro-8-methoxy-2,6,8-trimethylpyrrolo[2,3-g]quinazolin-7-one (CAS 2806023-03-8) is a chemical compound with the molecular formula C14H14ClN3O2 and a molecular weight of 291.73 g/mol. IUPAC name: (8S)-4-chloro-8-methoxy-2,6,8-trimethylpyrrolo[2,3-g]quinazolin-7-one. InChIKey: XAJOLHNVZYUCBF-AWEZNQCLSA-N.
| Molecular formula | C14H14ClN3O2 |
|---|---|
| Molecular weight | 291.73 g/mol |
| IUPAC name | (8S)-4-chloro-8-methoxy-2,6,8-trimethylpyrrolo[2,3-g]quinazolin-7-one |
| InChIKey | XAJOLHNVZYUCBF-AWEZNQCLSA-N |
| SMILES | CC1=NC2=CC3=C(C=C2C(=N1)Cl)N(C(=O)[C@@]3(C)OC)C |
Computed by PubChem (NCBI)