CAS 128322-44-1 appears in our catalog under these names: MCLA hydrochloride, Mcla, 95%, MCLA Hydrochloride, 2-Methyl-6-(4-methoxyphenyl)-3,7-dihydroimidazo(1,2-a)pyrazin-3-one hydrochloride, MCLA [Chemiluminescence Reagent], >98.0%(HPLC). Offered by: GLPBio, Combi-blocks, TRC, TargetMol, Biosynth. Available pack sizes: 1mg, 10mg, 100mg, 5mg, 20mg, 50mg, 250mg, 25mg.
6-(4-methoxyphenyl)-2-methylimidazo[1,2-a]pyrazin-3-ol;hydrochloride (CAS 128322-44-1) is a chemical compound with the molecular formula C14H14ClN3O2 and a molecular weight of 291.73 g/mol. IUPAC name: 6-(4-methoxyphenyl)-2-methylimidazo[1,2-a]pyrazin-3-ol;hydrochloride. InChIKey: MXZACTZQSGYANA-UHFFFAOYSA-N.
| Molecular formula | C14H14ClN3O2 |
|---|---|
| Molecular weight | 291.73 g/mol |
| IUPAC name | 6-(4-methoxyphenyl)-2-methylimidazo[1,2-a]pyrazin-3-ol;hydrochloride |
| InChIKey | MXZACTZQSGYANA-UHFFFAOYSA-N |
| SMILES | CC1=C(N2C=C(N=CC2=N1)C3=CC=C(C=C3)OC)O.Cl |
Computed by PubChem (NCBI)