CAS 312601-47-1 is the registry number for 3-Chloro-N-(2-(3,5-dimethyl-1H-pyrazol-1-yl)-2-oxoethyl)benzamide, 98%, 98%. Offered by: Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg.
3-chloro-N-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]benzamide (CAS 312601-47-1) is a chemical compound with the molecular formula C14H14ClN3O2 and a molecular weight of 291.73 g/mol. IUPAC name: 3-chloro-N-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]benzamide. InChIKey: ZHNZROFLIBUAAU-UHFFFAOYSA-N.
| Molecular formula | C14H14ClN3O2 |
|---|---|
| Molecular weight | 291.73 g/mol |
| IUPAC name | 3-chloro-N-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]benzamide |
| InChIKey | ZHNZROFLIBUAAU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C(=O)CNC(=O)C2=CC(=CC=C2)Cl)C |
Computed by PubChem (NCBI)