Products 164025-33-6
CAS 164025-33-6 is the registry number for PWZ-029. Offered by: MedChemExpress. Available pack sizes: Get quote.
8-chloro-3-(methoxymethyl)-5-methyl-4H-imidazo[1,5-a][1,4]benzodiazepin-6-one (CAS 164025-33-6) is a chemical compound with the molecular formula C14H14ClN3O2 and a molecular weight of 291.73 g/mol. IUPAC name: 8-chloro-3-(methoxymethyl)-5-methyl-4H-imidazo[1,5-a][1,4]benzodiazepin-6-one. InChIKey: FXIDXTIMKAEBGY-UHFFFAOYSA-N.
| Molecular formula | C14H14ClN3O2 |
|---|---|
| Molecular weight | 291.73 g/mol |
| IUPAC name | 8-chloro-3-(methoxymethyl)-5-methyl-4H-imidazo[1,5-a][1,4]benzodiazepin-6-one |
| InChIKey | FXIDXTIMKAEBGY-UHFFFAOYSA-N |
| SMILES | CN1CC2=C(N=CN2C3=C(C1=O)C=C(C=C3)Cl)COC |
Computed by PubChem (NCBI)