Products 2807467-70-3
CAS 2807467-70-3 is the registry number for 2-(Benzyloxy)-5-chloro-3-fluorobenzoic acid, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
5-chloro-3-fluoro-2-phenylmethoxybenzoic acid (CAS 2807467-70-3) is a chemical compound with the molecular formula C14H10ClFO3 and a molecular weight of 280.68 g/mol. IUPAC name: 5-chloro-3-fluoro-2-phenylmethoxybenzoic acid. InChIKey: PRXCXDCYTLPRQP-UHFFFAOYSA-N.
| Molecular formula | C14H10ClFO3 |
|---|---|
| Molecular weight | 280.68 g/mol |
| IUPAC name | 5-chloro-3-fluoro-2-phenylmethoxybenzoic acid |
| InChIKey | PRXCXDCYTLPRQP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2F)Cl)C(=O)O |
Computed by PubChem (NCBI)