CAS 28092-62-8 is the registry number for Biotin Impurity 13. Offered by: Chemat Brand. Available pack sizes: on request.
(3aS,6aR)-1,3-dibenzyl-6,6a-dihydro-3aH-furo[3,4-d]imidazole-2,4-dione (CAS 28092-62-8) is a chemical compound with the molecular formula C19H18N2O3 and a molecular weight of 322.4 g/mol. IUPAC name: (3aS,6aR)-1,3-dibenzyl-6,6a-dihydro-3aH-furo[3,4-d]imidazole-2,4-dione. InChIKey: FGFSEMWCZBVRHG-IRXDYDNUSA-N.
| Molecular formula | C19H18N2O3 |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | (3aS,6aR)-1,3-dibenzyl-6,6a-dihydro-3aH-furo[3,4-d]imidazole-2,4-dione |
| InChIKey | FGFSEMWCZBVRHG-IRXDYDNUSA-N |
| SMILES | C1[C@H]2[C@@H](C(=O)O1)N(C(=O)N2CC3=CC=CC=C3)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)