CAS 98516-72-4 appears in our catalog under these names: H-Phe-AMC, H–Phe–AMC, H-Phe-AMC trifluoroacetate salt, Phe-AMC. Offered by: Creative Peptides, GLPBio, Biosynth. Available pack sizes: 50mg, 250mg, 1g, 500mg, 1000mg, 5mg, 2000mg.
(2S)-2-amino-N-(4-methyl-2-oxochromen-7-yl)-3-phenylpropanamide (CAS 98516-72-4) is a chemical compound with the molecular formula C19H18N2O3 and a molecular weight of 322.4 g/mol. IUPAC name: (2S)-2-amino-N-(4-methyl-2-oxochromen-7-yl)-3-phenylpropanamide. InChIKey: UNWTXWNBQNGDDS-INIZCTEOSA-N.
| Molecular formula | C19H18N2O3 |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | (2S)-2-amino-N-(4-methyl-2-oxochromen-7-yl)-3-phenylpropanamide |
| InChIKey | UNWTXWNBQNGDDS-INIZCTEOSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)[C@H](CC3=CC=CC=C3)N |
Computed by PubChem (NCBI)