Products 484025-55-0
CAS 484025-55-0 is the registry number for 3-{[(Benzo[1,3]dioxol-5-ylmethyl)-amino]-methyl}-7-methyl-1H-quinolin-2-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(1,3-benzodioxol-5-ylmethylamino)methyl]-7-methyl-1H-quinolin-2-one (CAS 484025-55-0) is a chemical compound with the molecular formula C19H18N2O3 and a molecular weight of 322.4 g/mol. IUPAC name: 3-[(1,3-benzodioxol-5-ylmethylamino)methyl]-7-methyl-1H-quinolin-2-one. InChIKey: YBBAMZQEZRMBRK-UHFFFAOYSA-N.
| Molecular formula | C19H18N2O3 |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | 3-[(1,3-benzodioxol-5-ylmethylamino)methyl]-7-methyl-1H-quinolin-2-one |
| InChIKey | YBBAMZQEZRMBRK-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C=C(C(=O)N2)CNCC3=CC4=C(C=C3)OCO4 |
Computed by PubChem (NCBI)