CAS 28095-56-9 appears in our catalog under these names: H–DL–1–Nal–OH, 3-(1-Naphthyl)-DL-alanine, 95%, 95%, 2-Amino-3-(naphthalen-1-yl)propanoic acid, 98.47%, 2-Amino-3-(naphthalen-1-yl)propanoic acid, 97%. Offered by: GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 10g, 100g, 25g, 5g, 250mg, 1g, 10 g, 25 g.
2-amino-3-naphthalen-1-ylpropanoic acid (CAS 28095-56-9) is a chemical compound with the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. IUPAC name: 2-amino-3-naphthalen-1-ylpropanoic acid. InChIKey: OFYAYGJCPXRNBL-UHFFFAOYSA-N.
| Molecular formula | C13H13NO2 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | 2-amino-3-naphthalen-1-ylpropanoic acid |
| InChIKey | OFYAYGJCPXRNBL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2CC(C(=O)O)N |
Computed by PubChem (NCBI)