Products 2815-95-4
CAS 2815-95-4 appears in our catalog under these names: 3–(3,4–Methylenedioxyphenyl)propionic acid, 3-(3,4-Methylenedioxyphenyl)propionic acid/ 97+%, 3-(3,4-Methylenedioxyphenyl)propionic acid 97%, 3-(3,4-METHYLENEDIOXYPHENYL)PROPIONIC A&, 3-(3,4-Methylenedioxyphenyl)propionic acid, 97%, 97%. Offered by: GLPBio, Chemat, Ambeed, Sigma-Aldrich, Fluorochem. Available pack sizes: 100g, 1g, 25g, 5g.
3-(1,3-benzodioxol-5-yl)propanoic acid (CAS 2815-95-4) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: 3-(1,3-benzodioxol-5-yl)propanoic acid. InChIKey: UIYJGLLTSVRSBM-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 3-(1,3-benzodioxol-5-yl)propanoic acid |
| InChIKey | UIYJGLLTSVRSBM-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)CCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(3,4-Methylenedioxyphenyl)propionic acid, 1,3-Benzodioxole-5-propanoic acid, 3-(1,3-Benzodioxol-5-yl)propanoic acid, Hydrocinnamic acid, 3,4-(methylenedioxy)-, 1,3-Benzodioxole-5-propionic acid, 3,4-Methylenedioxyhydrocinnamic acid, Benzo-1,3-dioxole-5-propionic acid, 3-(benzo[d][1,3]dioxol-5-yl)propanoic acid, 3,4-(Methylenedioxy)hydrocinnamic acid, 3-(Benzodioxol-5-yl)propionic acid