CAS 28180-48-5 is the registry number for 2-(2-Bromophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol, 97%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
2-(2-bromophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol (CAS 28180-48-5) is a chemical compound with the molecular formula C9H5BrF6O and a molecular weight of 323.03 g/mol. IUPAC name: 2-(2-bromophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol. InChIKey: XXIHOAKCDPPBFG-UHFFFAOYSA-N.
| Molecular formula | C9H5BrF6O |
|---|---|
| Molecular weight | 323.03 g/mol |
| IUPAC name | 2-(2-bromophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
| InChIKey | XXIHOAKCDPPBFG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C(F)(F)F)(C(F)(F)F)O)Br |
Computed by PubChem (NCBI)