CAS 2819-59-2 is the registry number for N-(3,5-Dimethylphenyl)-2-hydroxybenzamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(3,5-dimethylphenyl)-2-hydroxybenzamide (CAS 2819-59-2) is a chemical compound with the molecular formula C15H15NO2 and a molecular weight of 241.28 g/mol. IUPAC name: N-(3,5-dimethylphenyl)-2-hydroxybenzamide. InChIKey: ACHGACVMWGAWDV-UHFFFAOYSA-N.
| Molecular formula | C15H15NO2 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | N-(3,5-dimethylphenyl)-2-hydroxybenzamide |
| InChIKey | ACHGACVMWGAWDV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)NC(=O)C2=CC=CC=C2O)C |
Computed by PubChem (NCBI)