CAS 282118-97-2 appears in our catalog under these names: 4-(Diisopropylamino)benzonitrile, 4-(Diisopropylamino)benzonitrile 95%. Offered by: TRC, Ambeed. Available pack sizes: 1g, 100mg, 250mg.
4-[di(propan-2-yl)amino]benzonitrile (CAS 282118-97-2) is a chemical compound with the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. IUPAC name: 4-[di(propan-2-yl)amino]benzonitrile. InChIKey: TWFWUDXARNEXLJ-UHFFFAOYSA-N.
| Molecular formula | C13H18N2 |
|---|---|
| Molecular weight | 202.30 g/mol |
| IUPAC name | 4-[di(propan-2-yl)amino]benzonitrile |
| InChIKey | TWFWUDXARNEXLJ-UHFFFAOYSA-N |
| SMILES | CC(C)N(C1=CC=C(C=C1)C#N)C(C)C |
Computed by PubChem (NCBI)