Products 2821751-71-5
CAS 2821751-71-5 is the registry number for 4-[1-Methyl-4-(trifluoromethyl)-1H-imidazol-2-yl]benzoic acid, 98%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg.
4-[1-methyl-4-(trifluoromethyl)imidazol-2-yl]benzoic acid (CAS 2821751-71-5) is a chemical compound with the molecular formula C12H9F3N2O2 and a molecular weight of 270.21 g/mol. IUPAC name: 4-[1-methyl-4-(trifluoromethyl)imidazol-2-yl]benzoic acid. InChIKey: CHXUBZUYOODBEK-UHFFFAOYSA-N.
| Molecular formula | C12H9F3N2O2 |
|---|---|
| Molecular weight | 270.21 g/mol |
| IUPAC name | 4-[1-methyl-4-(trifluoromethyl)imidazol-2-yl]benzoic acid |
| InChIKey | CHXUBZUYOODBEK-UHFFFAOYSA-N |
| SMILES | CN1C=C(N=C1C2=CC=C(C=C2)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)