CAS 28221-20-7 is the registry number for L-menthyl isovalerate . Offered by: TRC. Available pack sizes: 10g.
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-methylbutanoate (CAS 28221-20-7) is a chemical compound with the molecular formula C15H28O2 and a molecular weight of 240.38 g/mol. IUPAC name: [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-methylbutanoate. InChIKey: VYQSSWZYPCCBRN-HZSPNIEDSA-N.
| Molecular formula | C15H28O2 |
|---|---|
| Molecular weight | 240.38 g/mol |
| IUPAC name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-methylbutanoate |
| InChIKey | VYQSSWZYPCCBRN-HZSPNIEDSA-N |
| SMILES | C[C@@H]1CC[C@H]([C@@H](C1)OC(=O)CC(C)C)C(C)C |
Computed by PubChem (NCBI)