CAS 93757-41-6 appears in our catalog under these names: tert-Butyl undec-10-enoate, 95%, tert–Butyl undec–10–enoate, tert-Butyl undec-10-enoate, 96% (stabilized with TBC), 96% (stabilized with TBC), TERT-BUTYL UNDEC-10-ENOATE, 96% (stabilized with TBC). Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 100mg, 5g, 250mg, 50mg.
Tert-butyl undec-10-enoate (CAS 93757-41-6) is a chemical compound with the molecular formula C15H28O2 and a molecular weight of 240.38 g/mol. IUPAC name: tert-butyl undec-10-enoate. InChIKey: RKOBCJCSWMKBEH-UHFFFAOYSA-N.
| Molecular formula | C15H28O2 |
|---|---|
| Molecular weight | 240.38 g/mol |
| IUPAC name | tert-butyl undec-10-enoate |
| InChIKey | RKOBCJCSWMKBEH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCCCCCCCC=C |
Computed by PubChem (NCBI)