Products 4727-18-8

CAS 4727-18-8 is the registry number for 2-Hydroxycyclopentadecanone. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

2-hydroxycyclopentadecan-1-one (CAS 4727-18-8) is a chemical compound with the molecular formula C15H28O2 and a molecular weight of 240.38 g/mol. IUPAC name: 2-hydroxycyclopentadecan-1-one. InChIKey: UCPNHIPCCLLQGA-UHFFFAOYSA-N.

Identity
Molecular formulaC15H28O2
Molecular weight240.38 g/mol
IUPAC name2-hydroxycyclopentadecan-1-one
InChIKeyUCPNHIPCCLLQGA-UHFFFAOYSA-N
SMILESC1CCCCCCC(C(=O)CCCCCC1)O

Computed by PubChem (NCBI)