CAS 28231-03-0 is the registry number for Cedrenol. Offered by: MedChemExpress. Available pack sizes: Get quote.
2,6,6-trimethyl-8-methylidenetricyclo[5.3.1.01,5]undecan-9-ol (CAS 28231-03-0) is a chemical compound with the molecular formula C15H24O and a molecular weight of 220.35 g/mol. IUPAC name: 2,6,6-trimethyl-8-methylidenetricyclo[5.3.1.01,5]undecan-9-ol. InChIKey: DJYWGTBEZVORGE-UHFFFAOYSA-N.
| Molecular formula | C15H24O |
|---|---|
| Molecular weight | 220.35 g/mol |
| IUPAC name | 2,6,6-trimethyl-8-methylidenetricyclo[5.3.1.01,5]undecan-9-ol |
| InChIKey | DJYWGTBEZVORGE-UHFFFAOYSA-N |
| SMILES | CC1CCC2C13CC(C2(C)C)C(=C)C(C3)O |
Computed by PubChem (NCBI)