Products 2825-64-1

CAS 2825-64-1 is the registry number for N,2-Diphenylalanine, 95%. Offered by: Combi-blocks. Available pack sizes: 50g, 1g, 25g, 10g, 5g.

Structural formula: {0} (CAS {1})

(2R)-2-anilino-2-phenylpropanoic acid (CAS 2825-64-1) is a chemical compound with the molecular formula C15H15NO2 and a molecular weight of 241.28 g/mol. IUPAC name: (2R)-2-anilino-2-phenylpropanoic acid. InChIKey: AAEHCOPCHOUPLL-OAHLLOKOSA-N.

Identity
Molecular formulaC15H15NO2
Molecular weight241.28 g/mol
IUPAC name(2R)-2-anilino-2-phenylpropanoic acid
InChIKeyAAEHCOPCHOUPLL-OAHLLOKOSA-N
SMILESC[C@@](C1=CC=CC=C1)(C(=O)O)NC2=CC=CC=C2

Computed by PubChem (NCBI)