Products 2825693-21-6
CAS 2825693-21-6 is the registry number for 2,4-Dichloropyrazolo[1,5-a][1,3,5]triazine, 95%. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem. Available pack sizes: 250mg, 1g, 50mg, 100mg.
2,4-dichloropyrazolo[1,5-a][1,3,5]triazine (CAS 2825693-21-6) is a chemical compound with the molecular formula C5H2Cl2N4 and a molecular weight of 189.00 g/mol. IUPAC name: 2,4-dichloropyrazolo[1,5-a][1,3,5]triazine. InChIKey: JSPDLOCVQUYCMA-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N4 |
|---|---|
| Molecular weight | 189.00 g/mol |
| IUPAC name | 2,4-dichloropyrazolo[1,5-a][1,3,5]triazine |
| InChIKey | JSPDLOCVQUYCMA-UHFFFAOYSA-N |
| SMILES | C1=C2N=C(N=C(N2N=C1)Cl)Cl |
Computed by PubChem (NCBI)