CAS 2828433-63-0 appears in our catalog under these names: (R)-2-(5-Bromopyridin-2-yl)-4-(tert-butyl)-4,5-dihydrooxazole, 97% 99%ee, 97% 99%ee, (R)-2-(5-Bromopyridin-2-yl)-4-(tert-butyl)-4,5-dihydrooxazole, 97% 99%ee. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(4R)-2-(5-bromo-2-pyridinyl)-4-tert-butyl-4,5-dihydro-1,3-oxazole (CAS 2828433-63-0) is a chemical compound with the molecular formula C12H15BrN2O and a molecular weight of 283.16 g/mol. IUPAC name: (4R)-2-(5-bromo-2-pyridinyl)-4-tert-butyl-4,5-dihydro-1,3-oxazole. InChIKey: UPDHTVYVNBDRNC-JTQLQIEISA-N.
| Molecular formula | C12H15BrN2O |
|---|---|
| Molecular weight | 283.16 g/mol |
| IUPAC name | (4R)-2-(5-bromo-2-pyridinyl)-4-tert-butyl-4,5-dihydro-1,3-oxazole |
| InChIKey | UPDHTVYVNBDRNC-JTQLQIEISA-N |
| SMILES | CC(C)(C)[C@@H]1COC(=N1)C2=NC=C(C=C2)Br |
Computed by PubChem (NCBI)