Products 2828447-13-6
CAS 2828447-13-6 is the registry number for Methyl 2-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-yl)acetate, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg.
Methyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]acetate (CAS 2828447-13-6) is a chemical compound with the molecular formula C14H20BNO4 and a molecular weight of 277.13 g/mol. IUPAC name: methyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]acetate. InChIKey: UFVBZVQPRXDVQT-UHFFFAOYSA-N.
| Molecular formula | C14H20BNO4 |
|---|---|
| Molecular weight | 277.13 g/mol |
| IUPAC name | methyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]acetate |
| InChIKey | UFVBZVQPRXDVQT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC=C2)CC(=O)OC |
Computed by PubChem (NCBI)