Products 28328-56-5

CAS 28328-56-5 is the registry number for 3-Amino-5-(N-methylsulfamoyl)-4-phenoxybenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-amino-5-(methylsulfamoyl)-4-phenoxybenzoic acid (CAS 28328-56-5) is a chemical compound with the molecular formula C14H14N2O5S and a molecular weight of 322.34 g/mol. IUPAC name: 3-amino-5-(methylsulfamoyl)-4-phenoxybenzoic acid. InChIKey: NNZQIZYLXISQCS-UHFFFAOYSA-N.

Identity
Molecular formulaC14H14N2O5S
Molecular weight322.34 g/mol
IUPAC name3-amino-5-(methylsulfamoyl)-4-phenoxybenzoic acid
InChIKeyNNZQIZYLXISQCS-UHFFFAOYSA-N
SMILESCNS(=O)(=O)C1=CC(=CC(=C1OC2=CC=CC=C2)N)C(=O)O

Computed by PubChem (NCBI)