CAS 519153-00-5 appears in our catalog under these names: 2-Amino-5-((2-methoxyphenyl)sulfamoyl)benzoic acid, 95%, 2-Amino-5-((2-methoxyphenyl)sulfamoyl)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
2-amino-5-[(2-methoxyphenyl)sulfamoyl]benzoic acid (CAS 519153-00-5) is a chemical compound with the molecular formula C14H14N2O5S and a molecular weight of 322.34 g/mol. IUPAC name: 2-amino-5-[(2-methoxyphenyl)sulfamoyl]benzoic acid. InChIKey: YPLBETLVRBXNEI-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O5S |
|---|---|
| Molecular weight | 322.34 g/mol |
| IUPAC name | 2-amino-5-[(2-methoxyphenyl)sulfamoyl]benzoic acid |
| InChIKey | YPLBETLVRBXNEI-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1NS(=O)(=O)C2=CC(=C(C=C2)N)C(=O)O |
Computed by PubChem (NCBI)