CAS 455304-63-9 is the registry number for SARS-CoV-2-IN-113. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-methyl-N-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]benzenesulfonamide (CAS 455304-63-9) is a chemical compound with the molecular formula C14H14N2O5S and a molecular weight of 322.34 g/mol. IUPAC name: 4-methyl-N-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]benzenesulfonamide. InChIKey: CBTDPHJXQDKURW-OVCLIPMQSA-N.
| Molecular formula | C14H14N2O5S |
|---|---|
| Molecular weight | 322.34 g/mol |
| IUPAC name | 4-methyl-N-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]benzenesulfonamide |
| InChIKey | CBTDPHJXQDKURW-OVCLIPMQSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N/N=C/C2=C(C(=C(C=C2)O)O)O |
Computed by PubChem (NCBI)