Products 2832828-59-6
CAS 2832828-59-6 is the registry number for 2-(((1-(3-Carboxypropyl)piperidin-4-yl)oxy)(4-chlorophenyl)methyl)pyridine 1-oxide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-[4-[(4-chlorophenyl)-(1-oxidopyridin-1-ium-2-yl)methoxy]piperidin-1-yl]butanoic acid (CAS 2832828-59-6) is a chemical compound with the molecular formula C21H25ClN2O4 and a molecular weight of 404.9 g/mol. IUPAC name: 4-[4-[(4-chlorophenyl)-(1-oxidopyridin-1-ium-2-yl)methoxy]piperidin-1-yl]butanoic acid. InChIKey: XFSNDAFZKQDOHH-UHFFFAOYSA-N.
| Molecular formula | C21H25ClN2O4 |
|---|---|
| Molecular weight | 404.9 g/mol |
| IUPAC name | 4-[4-[(4-chlorophenyl)-(1-oxidopyridin-1-ium-2-yl)methoxy]piperidin-1-yl]butanoic acid |
| InChIKey | XFSNDAFZKQDOHH-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1OC(C2=CC=C(C=C2)Cl)C3=CC=CC=[N+]3[O-])CCCC(=O)O |
Computed by PubChem (NCBI)