CAS 442863-80-1 appears in our catalog under these names: Cetirizine Impurity 64, (R)-Cetirizine N-Oxide (>90%), (R)-Cetirizine N-oxide. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 100mg, 10mg, 2mg, 1mg, 5mg.
2-[2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]-1-oxidopiperazin-1-ium-1-yl]ethoxy]acetic acid (CAS 442863-80-1) is a chemical compound with the molecular formula C21H25ClN2O4 and a molecular weight of 404.9 g/mol. IUPAC name: 2-[2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]-1-oxidopiperazin-1-ium-1-yl]ethoxy]acetic acid. InChIKey: IVDOUUOLLFEMJQ-OAQYLSRUSA-N.
| Molecular formula | C21H25ClN2O4 |
|---|---|
| Molecular weight | 404.9 g/mol |
| IUPAC name | 2-[2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]-1-oxidopiperazin-1-ium-1-yl]ethoxy]acetic acid |
| InChIKey | IVDOUUOLLFEMJQ-OAQYLSRUSA-N |
| SMILES | C1C[N+](CCN1[C@H](C2=CC=CC=C2)C3=CC=C(C=C3)Cl)(CCOCC(=O)O)[O-] |
Computed by PubChem (NCBI)