Products 137888-11-0
CAS 137888-11-0 appears in our catalog under these names: Carmoterol Hydrochloride, >95% (HPLC), Carmoterol hydrochloride, Carmoterol (hydrochloride), 98.73%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 10mM (in 1ml dmso), 1 mg, 5 mg, 50 mg, 10mM/1mL, 10 mg.
8-hydroxy-5-[(1R)-1-hydroxy-2-[[(2R)-1-(4-methoxyphenyl)propan-2-yl]amino]ethyl]-1H-quinolin-2-one;hydrochloride (CAS 137888-11-0) is a chemical compound with the molecular formula C21H25ClN2O4 and a molecular weight of 404.9 g/mol. IUPAC name: 8-hydroxy-5-[(1R)-1-hydroxy-2-[[(2R)-1-(4-methoxyphenyl)propan-2-yl]amino]ethyl]-1H-quinolin-2-one;hydrochloride. InChIKey: SYCWERNQGSKYAG-QVRIGTRMSA-N.
| Molecular formula | C21H25ClN2O4 |
|---|---|
| Molecular weight | 404.9 g/mol |
| IUPAC name | 8-hydroxy-5-[(1R)-1-hydroxy-2-[[(2R)-1-(4-methoxyphenyl)propan-2-yl]amino]ethyl]-1H-quinolin-2-one;hydrochloride |
| InChIKey | SYCWERNQGSKYAG-QVRIGTRMSA-N |
| SMILES | C[C@H](CC1=CC=C(C=C1)OC)NC[C@@H](C2=C3C=CC(=O)NC3=C(C=C2)O)O.Cl |
Computed by PubChem (NCBI)