Products 367272-52-4
CAS 367272-52-4 is the registry number for N6-((9H-Fluoren-9-ylmethoxy)carbonyl)-D-lysine monohydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g.
(2R)-2-amino-6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid;hydrochloride (CAS 367272-52-4) is a chemical compound with the molecular formula C21H25ClN2O4 and a molecular weight of 404.9 g/mol. IUPAC name: (2R)-2-amino-6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid;hydrochloride. InChIKey: BSLVUEJQCVSAGF-FSRHSHDFSA-N.
| Molecular formula | C21H25ClN2O4 |
|---|---|
| Molecular weight | 404.9 g/mol |
| IUPAC name | (2R)-2-amino-6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid;hydrochloride |
| InChIKey | BSLVUEJQCVSAGF-FSRHSHDFSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCCC[C@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)