Products 2833669-73-9
CAS 2833669-73-9 is the registry number for 6-Bromo-2-methylpyrido[2,3-d]pyrimidine-4,7(3H,8H)-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-2-methyl-3,8-dihydropyrido[2,3-d]pyrimidine-4,7-dione (CAS 2833669-73-9) is a chemical compound with the molecular formula C8H6BrN3O2 and a molecular weight of 256.06 g/mol. IUPAC name: 6-bromo-2-methyl-3,8-dihydropyrido[2,3-d]pyrimidine-4,7-dione. InChIKey: FTHUFCVEPBHETE-UHFFFAOYSA-N.
| Molecular formula | C8H6BrN3O2 |
|---|---|
| Molecular weight | 256.06 g/mol |
| IUPAC name | 6-bromo-2-methyl-3,8-dihydropyrido[2,3-d]pyrimidine-4,7-dione |
| InChIKey | FTHUFCVEPBHETE-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C(C(=O)N2)Br)C(=O)N1 |
Computed by PubChem (NCBI)