CAS 2833727-43-6 is the registry number for TRPM2-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-benzoyl-N,N-diethylindolizine-7-carboxamide (CAS 2833727-43-6) is a chemical compound with the molecular formula C20H20N2O2 and a molecular weight of 320.4 g/mol. IUPAC name: 5-benzoyl-N,N-diethylindolizine-7-carboxamide. InChIKey: XSMHHVFLOMVAOP-UHFFFAOYSA-N.
| Molecular formula | C20H20N2O2 |
|---|---|
| Molecular weight | 320.4 g/mol |
| IUPAC name | 5-benzoyl-N,N-diethylindolizine-7-carboxamide |
| InChIKey | XSMHHVFLOMVAOP-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=CC2=CC=CN2C(=C1)C(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)