CAS 2834759-45-2 is the registry number for tert-butyl (1R,2R,5S)-2-(hydroxymethyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Tert-butyl (1R,2R,5S)-2-(hydroxymethyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (CAS 2834759-45-2) is a chemical compound with the molecular formula C12H22N2O3 and a molecular weight of 242.31 g/mol. IUPAC name: tert-butyl (1R,2R,5S)-2-(hydroxymethyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate. InChIKey: JHOFNBMKSZPAMM-LPEHRKFASA-N.
| Molecular formula | C12H22N2O3 |
|---|---|
| Molecular weight | 242.31 g/mol |
| IUPAC name | tert-butyl (1R,2R,5S)-2-(hydroxymethyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| InChIKey | JHOFNBMKSZPAMM-LPEHRKFASA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@H]2CC[C@@H]1[C@@H](NC2)CO |
Computed by PubChem (NCBI)