Products 28360-89-6
CAS 28360-89-6 appears in our catalog under these names: (E)–Crotylbarbital, (E)-Crotylbarbital. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 50mg, 100mg, 200mg, 1 mg, 5mg, 10mg, 25mg.
5-[(E)-but-2-enyl]-5-ethyl-1,3-diazinane-2,4,6-trione (CAS 28360-89-6) is a chemical compound with the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. IUPAC name: 5-[(E)-but-2-enyl]-5-ethyl-1,3-diazinane-2,4,6-trione. InChIKey: KNMOHCLEINXVBG-HWKANZROSA-N.
| Molecular formula | C10H14N2O3 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 5-[(E)-but-2-enyl]-5-ethyl-1,3-diazinane-2,4,6-trione |
| InChIKey | KNMOHCLEINXVBG-HWKANZROSA-N |
| SMILES | CCC1(C(=O)NC(=O)NC1=O)C/C=C/C |
Computed by PubChem (NCBI)