Products 2839836-48-3
CAS 2839836-48-3 is the registry number for tert-Butyl 4-fluoro-5-hydroxyisoindoline-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 4-fluoro-5-hydroxy-1,3-dihydroisoindole-2-carboxylate (CAS 2839836-48-3) is a chemical compound with the molecular formula C13H16FNO3 and a molecular weight of 253.27 g/mol. IUPAC name: tert-butyl 4-fluoro-5-hydroxy-1,3-dihydroisoindole-2-carboxylate. InChIKey: XGNWXMSFNOSJPS-UHFFFAOYSA-N.
| Molecular formula | C13H16FNO3 |
|---|---|
| Molecular weight | 253.27 g/mol |
| IUPAC name | tert-butyl 4-fluoro-5-hydroxy-1,3-dihydroisoindole-2-carboxylate |
| InChIKey | XGNWXMSFNOSJPS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(C1)C(=C(C=C2)O)F |
Computed by PubChem (NCBI)