CAS 28400-12-6 is the registry number for alpha-Alaskene. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg.
(1S,5R)-1,8-dimethyl-4-propan-2-ylidenespiro[4.5]dec-8-ene (CAS 28400-12-6) is a chemical compound with the molecular formula C15H24 and a molecular weight of 204.35 g/mol. IUPAC name: (1S,5R)-1,8-dimethyl-4-propan-2-ylidenespiro[4.5]dec-8-ene. InChIKey: HMKLOOMRRZKSNM-ZFWWWQNUSA-N.
| Molecular formula | C15H24 |
|---|---|
| Molecular weight | 204.35 g/mol |
| IUPAC name | (1S,5R)-1,8-dimethyl-4-propan-2-ylidenespiro[4.5]dec-8-ene |
| InChIKey | HMKLOOMRRZKSNM-ZFWWWQNUSA-N |
| SMILES | C[C@H]1CCC(=C(C)C)[C@@]12CCC(=CC2)C |
Computed by PubChem (NCBI)