CAS 94063-01-1 is the registry number for DL-N5-(naphthalen-1-yl)glutamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-5-(naphthalen-1-ylamino)-5-oxopentanoic acid (CAS 94063-01-1) is a chemical compound with the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. IUPAC name: 2-amino-5-(naphthalen-1-ylamino)-5-oxopentanoic acid. InChIKey: QOGFVABMAJFJDJ-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O3 |
|---|---|
| Molecular weight | 272.30 g/mol |
| IUPAC name | 2-amino-5-(naphthalen-1-ylamino)-5-oxopentanoic acid |
| InChIKey | QOGFVABMAJFJDJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2NC(=O)CCC(C(=O)O)N |
Computed by PubChem (NCBI)