Products 2840168-85-4
CAS 2840168-85-4 is the registry number for 5-(Trifluoromethyl)-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
5-(trifluoromethyl)-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride (CAS 2840168-85-4) is a chemical compound with the molecular formula C11H13ClF3N and a molecular weight of 251.67 g/mol. IUPAC name: 5-(trifluoromethyl)-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride. InChIKey: DDUGEEHWCMBQPR-UHFFFAOYSA-N.
| Molecular formula | C11H13ClF3N |
|---|---|
| Molecular weight | 251.67 g/mol |
| IUPAC name | 5-(trifluoromethyl)-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride |
| InChIKey | DDUGEEHWCMBQPR-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)C(=CC=C2)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)