Products 2840558-89-4
CAS 2840558-89-4 is the registry number for LG157. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-methoxy-N-methyl-5-[[3-(2-methyl-4-pyridinyl)-2-pyridinyl]oxy]benzamide (CAS 2840558-89-4) is a chemical compound with the molecular formula C20H19N3O3 and a molecular weight of 349.4 g/mol. IUPAC name: 3-methoxy-N-methyl-5-[[3-(2-methyl-4-pyridinyl)-2-pyridinyl]oxy]benzamide. InChIKey: LEBFJZAXIOHFOU-UHFFFAOYSA-N.
| Molecular formula | C20H19N3O3 |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | 3-methoxy-N-methyl-5-[[3-(2-methyl-4-pyridinyl)-2-pyridinyl]oxy]benzamide |
| InChIKey | LEBFJZAXIOHFOU-UHFFFAOYSA-N |
| SMILES | CC1=NC=CC(=C1)C2=C(N=CC=C2)OC3=CC(=CC(=C3)OC)C(=O)NC |
Computed by PubChem (NCBI)