CAS 2840639-30-5 is the registry number for (S)-1-(tert-Butoxycarbonyl)-1,4-diazepane-6-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(6S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-1,4-diazepane-6-carboxylic acid (CAS 2840639-30-5) is a chemical compound with the molecular formula C11H20N2O4 and a molecular weight of 244.29 g/mol. IUPAC name: (6S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-1,4-diazepane-6-carboxylic acid. InChIKey: BHHMBSJKWNFLBL-QMMMGPOBSA-N.
| Molecular formula | C11H20N2O4 |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | (6S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-1,4-diazepane-6-carboxylic acid |
| InChIKey | BHHMBSJKWNFLBL-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCNC[C@@H](C1)C(=O)O |
Computed by PubChem (NCBI)