Products 2841454-63-3
CAS 2841454-63-3 is the registry number for 6-(tert-Butyl) 3-ethyl 2-amino-5,5-dimethyl-4,7-dihydrothieno[2,3-c]pyridine-3,6(5H)-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-O-tert-butyl 3-O-ethyl 2-amino-5,5-dimethyl-4,7-dihydrothieno[2,3-c]pyridine-3,6-dicarboxylate (CAS 2841454-63-3) is a chemical compound with the molecular formula C17H26N2O4S and a molecular weight of 354.5 g/mol. IUPAC name: 6-O-tert-butyl 3-O-ethyl 2-amino-5,5-dimethyl-4,7-dihydrothieno[2,3-c]pyridine-3,6-dicarboxylate. InChIKey: FPPOCNGZIOTXGH-UHFFFAOYSA-N.
| Molecular formula | C17H26N2O4S |
|---|---|
| Molecular weight | 354.5 g/mol |
| IUPAC name | 6-O-tert-butyl 3-O-ethyl 2-amino-5,5-dimethyl-4,7-dihydrothieno[2,3-c]pyridine-3,6-dicarboxylate |
| InChIKey | FPPOCNGZIOTXGH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(SC2=C1CC(N(C2)C(=O)OC(C)(C)C)(C)C)N |
Computed by PubChem (NCBI)