Products 854357-46-3
CAS 854357-46-3 is the registry number for 5-(Diethylsulfamoyl)-2-(4-methylpiperidin-1-yl)benzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
5-(diethylsulfamoyl)-2-(4-methylpiperidin-1-yl)benzoic acid (CAS 854357-46-3) is a chemical compound with the molecular formula C17H26N2O4S and a molecular weight of 354.5 g/mol. IUPAC name: 5-(diethylsulfamoyl)-2-(4-methylpiperidin-1-yl)benzoic acid. InChIKey: ONVBYGSYSFIRRP-UHFFFAOYSA-N.
| Molecular formula | C17H26N2O4S |
|---|---|
| Molecular weight | 354.5 g/mol |
| IUPAC name | 5-(diethylsulfamoyl)-2-(4-methylpiperidin-1-yl)benzoic acid |
| InChIKey | ONVBYGSYSFIRRP-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=CC(=C(C=C1)N2CCC(CC2)C)C(=O)O |
Computed by PubChem (NCBI)