CAS 1432063-44-9 is the registry number for tert-Butyl 4-(((4-aminophenyl)sulfonyl)methyl)piperidine-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Tert-butyl 4-[(4-aminophenyl)sulfonylmethyl]piperidine-1-carboxylate (CAS 1432063-44-9) is a chemical compound with the molecular formula C17H26N2O4S and a molecular weight of 354.5 g/mol. IUPAC name: tert-butyl 4-[(4-aminophenyl)sulfonylmethyl]piperidine-1-carboxylate. InChIKey: PUTPMAXENKUWJK-UHFFFAOYSA-N.
| Molecular formula | C17H26N2O4S |
|---|---|
| Molecular weight | 354.5 g/mol |
| IUPAC name | tert-butyl 4-[(4-aminophenyl)sulfonylmethyl]piperidine-1-carboxylate |
| InChIKey | PUTPMAXENKUWJK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)CS(=O)(=O)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)