CAS 474843-69-1 appears in our catalog under these names: 2-Amino-4,7-dihydro-5h-thieno[2,3-c]pyridine-3,6-dicarboxylic acid di-tert-butyl ester, 95%, Di-tert-butyl 2-amino-4,5-dihydrothieno(2,3-c)pyridine-3,6(7H)-dicarboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 1g.
Ditert-butyl 2-amino-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate (CAS 474843-69-1) is a chemical compound with the molecular formula C17H26N2O4S and a molecular weight of 354.5 g/mol. IUPAC name: ditert-butyl 2-amino-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate. InChIKey: PNNUJPFKUDXJCP-UHFFFAOYSA-N.
| Molecular formula | C17H26N2O4S |
|---|---|
| Molecular weight | 354.5 g/mol |
| IUPAC name | ditert-butyl 2-amino-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate |
| InChIKey | PNNUJPFKUDXJCP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(SC2=C1CCN(C2)C(=O)OC(C)(C)C)N |
Computed by PubChem (NCBI)